C16H13F2N5O4S — CID 19476493
N-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-1-ethyl-4-nitropyrazole-5-carboxamide (PubChem CID 19476493) has the molecular formula C16H13F2N5O4S and a molecular weight of 409.37 g/mol. Its IUPAC name is N-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-1-ethyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-1-ethyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19476493 |
| Molecular Formula | C16H13F2N5O4S |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | N-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-1-ethyl-4-nitropyrazole-5-carboxamide |
| SMILES | CCn1ncc([N+](=O)[O-])c1C(=O)Nc1nc(-c2ccc(OC(F)F)cc2)cs1 |
| InChI | InChI=1S/C16H13F2N5O4S/c1-2-22-13(12(7-19-22)23(25)26)14(24)21-16-20-11(8-28-16)9-3-5-10(6-4-9)27-15(17)18/h3-8,15H,2H2,1H3,(H,20,21,24) |
| InChIKey | VTGMFJXDVNSGHA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|