C12H7F2N5O4S — CID 4866541
N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 4866541) has the molecular formula C12H7F2N5O4S and a molecular weight of 355.28 g/mol. Its IUPAC name is N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4866541 |
| Molecular Formula | C12H7F2N5O4S |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1nc2ccc(OC(F)F)cc2s1)c1[nH]ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H7F2N5O4S/c13-11(14)23-5-1-2-6-8(3-5)24-12(16-6)17-10(20)9-7(19(21)22)4-15-18-9/h1-4,11H,(H,15,18)(H,16,17,20) |
| InChIKey | WDYZDUJCJAFZPQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|