C18H14F2N4O5S — CID 52684564
N-[4-[4-(difluoromethoxy)phenyl]-5-methyl-1,3-thiazol-2-yl]-2-(5-nitro-2-oxo-1-pyridinyl)acetamide (PubChem CID 52684564) has the molecular formula C18H14F2N4O5S and a molecular weight of 436.40 g/mol. Its IUPAC name is N-[4-[4-(difluoromethoxy)phenyl]-5-methyl-1,3-thiazol-2-yl]-2-(5-nitro-2-oxo-1-pyridinyl)acetamide.
| Compound Name | N-[4-[4-(difluoromethoxy)phenyl]-5-methyl-1,3-thiazol-2-yl]-2-(5-nitro-2-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 52684564 |
| Molecular Formula | C18H14F2N4O5S |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | N-[4-[4-(difluoromethoxy)phenyl]-5-methyl-1,3-thiazol-2-yl]-2-(5-nitro-2-oxo-1-pyridinyl)acetamide |
| SMILES | Cc1sc(NC(=O)Cn2cc([N+](=O)[O-])ccc2=O)nc1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H14F2N4O5S/c1-10-16(11-2-5-13(6-3-11)29-17(19)20)22-18(30-10)21-14(25)9-23-8-12(24(27)28)4-7-15(23)26/h2-8,17H,9H2,1H3,(H,21,22,25) |
| InChIKey | CFNPKSBYUALMGI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|