C14H16N4O2S — CID 86790768
N-[cyclopropyl-(4-methylpyrimidin-2-yl)methyl]pyridine-3-sulfonamide (PubChem CID 86790768) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is N-[cyclopropyl-(4-methylpyrimidin-2-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | N-[cyclopropyl-(4-methylpyrimidin-2-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 86790768 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-[cyclopropyl-(4-methylpyrimidin-2-yl)methyl]pyridine-3-sulfonamide |
| SMILES | Cc1ccnc(C(NS(=O)(=O)c2cccnc2)C2CC2)n1 |
| InChI | InChI=1S/C14H16N4O2S/c1-10-6-8-16-14(17-10)13(11-4-5-11)18-21(19,20)12-3-2-7-15-9-12/h2-3,6-9,11,13,18H,4-5H2,1H3 |
| InChIKey | CEJGLZYEIJLXMD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |