C12H19N5O2 — CID 86791829
2-[(1-ethylpyrazol-4-yl)amino]-N-(prop-2-enylcarbamoyl)propanamide (PubChem CID 86791829) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-[(1-ethylpyrazol-4-yl)amino]-N-(prop-2-enylcarbamoyl)propanamide.
| Compound Name | 2-[(1-ethylpyrazol-4-yl)amino]-N-(prop-2-enylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 86791829 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-[(1-ethylpyrazol-4-yl)amino]-N-(prop-2-enylcarbamoyl)propanamide |
| SMILES | C=CCNC(=O)NC(=O)C(C)Nc1cnn(CC)c1 |
| InChI | InChI=1S/C12H19N5O2/c1-4-6-13-12(19)16-11(18)9(3)15-10-7-14-17(5-2)8-10/h4,7-9,15H,1,5-6H2,2-3H3,(H2,13,16,18,19) |
| InChIKey | WELAXSXAMFZJSJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|