C16H22Br2N4O — CID 86793816
3-[(2-amino-3,5-dibromophenyl)methyl-(2-morpholin-4-ylethyl)amino]propanenitrile (PubChem CID 86793816) has the molecular formula C16H22Br2N4O and a molecular weight of 446.19 g/mol. Its IUPAC name is 3-[(2-amino-3,5-dibromophenyl)methyl-(2-morpholin-4-ylethyl)amino]propanenitrile.
| Compound Name | 3-[(2-amino-3,5-dibromophenyl)methyl-(2-morpholin-4-ylethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 86793816 |
| Molecular Formula | C16H22Br2N4O |
| Molecular Weight | 446.19 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 3-[(2-amino-3,5-dibromophenyl)methyl-(2-morpholin-4-ylethyl)amino]propanenitrile |
| SMILES | N#CCCN(CCN1CCOCC1)Cc1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C16H22Br2N4O/c17-14-10-13(16(20)15(18)11-14)12-22(3-1-2-19)5-4-21-6-8-23-9-7-21/h10-11H,1,3-9,12,20H2 |
| InChIKey | DXFDEEGQPIIASK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.19 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|