C9H10BrF2NO3S — CID 86794019
N-(2-bromo-4,6-difluorophenyl)-2-methoxyethanesulfonamide (PubChem CID 86794019) has the molecular formula C9H10BrF2NO3S and a molecular weight of 330.15 g/mol. Its IUPAC name is N-(2-bromo-4,6-difluorophenyl)-2-methoxyethanesulfonamide.
| Compound Name | N-(2-bromo-4,6-difluorophenyl)-2-methoxyethanesulfonamide |
|---|---|
| PubChem CID | 86794019 |
| Molecular Formula | C9H10BrF2NO3S |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | N-(2-bromo-4,6-difluorophenyl)-2-methoxyethanesulfonamide |
| SMILES | COCCS(=O)(=O)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C9H10BrF2NO3S/c1-16-2-3-17(14,15)13-9-7(10)4-6(11)5-8(9)12/h4-5,13H,2-3H2,1H3 |
| InChIKey | SDLFBOFQBDRFES-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |