About 2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate
2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate (PubChem CID 86794909) has the molecular formula C15H12F2N4O2
and a molecular weight of 318.28 g/mol. Its IUPAC name is 2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate |
| PubChem CID | 86794909 |
| Molecular Formula | C15H12F2N4O2 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate |
| SMILES | O=C(OCCc1cn[nH]c1)c1cn[nH]c1-c1c(F)cccc1F |
| InChI | InChI=1S/C15H12F2N4O2/c16-11-2-1-3-12(17)13(11)14-10(8-20-21-14)15(22)23-5-4-9-6-18-19-7-9/h1-3,6-8H,4-5H2,(H,18,19)(H,20,21) |
| InChIKey | XVPDKKFJJSIDNP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate?
The IUPAC name of 2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate (CID 86794909) is 2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate.
What is the SMILES notation for 2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate?
The canonical SMILES for 2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate is O=C(OCCc1cn[nH]c1)c1cn[nH]c1-c1c(F)cccc1F.
What is the InChIKey of 2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate?
The InChIKey is XVPDKKFJJSIDNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N4O2/c16-11-2-1-3-12(17)13(11)14-10(8-20-21-14)15(22)23-5-4-9-6-18-19-7-9/h1-3,6-8H,4-5H2,(H,18,19)(H,20,21).
What are the key properties of 2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate?
2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate has a molecular weight of 318.28 g/mol, XLogP of 2.48, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrazol-4-yl)ethyl 5-(2,6-difluorophenyl)-1H-pyrazole-4-carboxylate is sourced from PubChem (CID 86794909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).