C12H15N7O2 — CID 86795055
6-methyl-3-nitro-2-[3-(2H-tetrazol-5-yl)piperidin-1-yl]pyridine (PubChem CID 86795055) has the molecular formula C12H15N7O2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 6-methyl-3-nitro-2-[3-(2H-tetrazol-5-yl)piperidin-1-yl]pyridine.
| Compound Name | 6-methyl-3-nitro-2-[3-(2H-tetrazol-5-yl)piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 86795055 |
| Molecular Formula | C12H15N7O2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 6-methyl-3-nitro-2-[3-(2H-tetrazol-5-yl)piperidin-1-yl]pyridine |
| SMILES | Cc1ccc([N+](=O)[O-])c(N2CCCC(c3nn[nH]n3)C2)n1 |
| InChI | InChI=1S/C12H15N7O2/c1-8-4-5-10(19(20)21)12(13-8)18-6-2-3-9(7-18)11-14-16-17-15-11/h4-5,9H,2-3,6-7H2,1H3,(H,14,15,16,17) |
| InChIKey | IBWALRLSGXAGOC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|