C17H28N2O2S — CID 86795940
3-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(5-methylhexan-2-yl)aniline (PubChem CID 86795940) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(5-methylhexan-2-yl)aniline.
| Compound Name | 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(5-methylhexan-2-yl)aniline |
|---|---|
| PubChem CID | 86795940 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(5-methylhexan-2-yl)aniline |
| SMILES | CC(C)CCC(C)Nc1cccc(N2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C17H28N2O2S/c1-14(2)7-8-15(3)18-16-5-4-6-17(13-16)19-9-11-22(20,21)12-10-19/h4-6,13-15,18H,7-12H2,1-3H3 |
| InChIKey | ZFQVSVANRPXFRH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |