C11H10BrN3O4 — CID 86798983
3-[(2-bromo-4-nitrophenyl)methyl]-1-methylimidazolidine-2,4-dione (PubChem CID 86798983) has the molecular formula C11H10BrN3O4 and a molecular weight of 328.12 g/mol. Its IUPAC name is 3-[(2-bromo-4-nitrophenyl)methyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(2-bromo-4-nitrophenyl)methyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 86798983 |
| Molecular Formula | C11H10BrN3O4 |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 3-[(2-bromo-4-nitrophenyl)methyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(Cc2ccc([N+](=O)[O-])cc2Br)C1=O |
| InChI | InChI=1S/C11H10BrN3O4/c1-13-6-10(16)14(11(13)17)5-7-2-3-8(15(18)19)4-9(7)12/h2-4H,5-6H2,1H3 |
| InChIKey | LMVGVBFXOGZNCC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|