C12H10BrN3O5 — CID 60792491
1-[(2-bromo-4-nitrophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxylic acid (PubChem CID 60792491) has the molecular formula C12H10BrN3O5 and a molecular weight of 356.13 g/mol. Its IUPAC name is 1-[(2-bromo-4-nitrophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxylic acid.
| Compound Name | 1-[(2-bromo-4-nitrophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 60792491 |
| Molecular Formula | C12H10BrN3O5 |
| Molecular Weight | 356.13 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 1-[(2-bromo-4-nitrophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxylic acid |
| SMILES | O=C(O)C1=NN(Cc2ccc([N+](=O)[O-])cc2Br)C(=O)CC1 |
| InChI | InChI=1S/C12H10BrN3O5/c13-9-5-8(16(20)21)2-1-7(9)6-15-11(17)4-3-10(14-15)12(18)19/h1-2,5H,3-4,6H2,(H,18,19) |
| InChIKey | GIUYDDZDMFCZAX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.13 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|