C12H13FN4O4S — CID 86799386
N-(1,5-dimethylpyrazol-3-yl)-3-fluoro-4-methyl-5-nitrobenzenesulfonamide (PubChem CID 86799386) has the molecular formula C12H13FN4O4S and a molecular weight of 328.33 g/mol. Its IUPAC name is N-(1,5-dimethylpyrazol-3-yl)-3-fluoro-4-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(1,5-dimethylpyrazol-3-yl)-3-fluoro-4-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 86799386 |
| Molecular Formula | C12H13FN4O4S |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | N-(1,5-dimethylpyrazol-3-yl)-3-fluoro-4-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1c(F)cc(S(=O)(=O)Nc2cc(C)n(C)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13FN4O4S/c1-7-4-12(14-16(7)3)15-22(20,21)9-5-10(13)8(2)11(6-9)17(18)19/h4-6H,1-3H3,(H,14,15) |
| InChIKey | BAJUIXPUFOBAJF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|