C21H27N3OS — CID 8680312
2-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(3-ethylpent-1-yn-3-yl)acetamide (PubChem CID 8680312) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is 2-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(3-ethylpent-1-yn-3-yl)acetamide.
| Compound Name | 2-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(3-ethylpent-1-yn-3-yl)acetamide |
|---|---|
| PubChem CID | 8680312 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(3-ethylpent-1-yn-3-yl)acetamide |
| SMILES | C#CC(CC)(CC)NC(=O)CN1CCC[C@H](c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C21H27N3OS/c1-4-21(5-2,6-3)23-19(25)15-24-13-9-10-16(14-24)20-22-17-11-7-8-12-18(17)26-20/h1,7-8,11-12,16H,5-6,9-10,13-15H2,2-3H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | MWTBRJANBKIPEF-INIZCTEOSA-N |
| XLogP | 3.78 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|