C22H25N3O2S — CID 9389196
2-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 9389196) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9389196 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2CCC[C@H](c3nc4ccccc4s3)C2)cc1 |
| InChI | InChI=1S/C22H25N3O2S/c1-2-27-18-11-9-17(10-12-18)23-21(26)15-25-13-5-6-16(14-25)22-24-19-7-3-4-8-20(19)28-22/h3-4,7-12,16H,2,5-6,13-15H2,1H3,(H,23,26)/t16-/m0/s1 |
| InChIKey | JLQFICJUUZVOBK-INIZCTEOSA-N |
| XLogP | 4.51 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |