C22H25N3O2S — CID 17437438
2-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(2-phenoxyethyl)acetamide (PubChem CID 17437438) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 17437438 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(2-phenoxyethyl)acetamide |
| SMILES | O=C(CN1CCCC(c2nc3ccccc3s2)C1)NCCOc1ccccc1 |
| InChI | InChI=1S/C22H25N3O2S/c26-21(23-12-14-27-18-8-2-1-3-9-18)16-25-13-6-7-17(15-25)22-24-19-10-4-5-11-20(19)28-22/h1-5,8-11,17H,6-7,12-16H2,(H,23,26) |
| InChIKey | LSUJQLJPXWTJRZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|