C10H10ClN3O3S — CID 86807360
N-(5-chloropyrazin-2-yl)-2,5-dimethylfuran-3-sulfonamide (PubChem CID 86807360) has the molecular formula C10H10ClN3O3S and a molecular weight of 287.73 g/mol. Its IUPAC name is N-(5-chloropyrazin-2-yl)-2,5-dimethylfuran-3-sulfonamide.
| Compound Name | N-(5-chloropyrazin-2-yl)-2,5-dimethylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 86807360 |
| Molecular Formula | C10H10ClN3O3S |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | N-(5-chloropyrazin-2-yl)-2,5-dimethylfuran-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2cnc(Cl)cn2)c(C)o1 |
| InChI | InChI=1S/C10H10ClN3O3S/c1-6-3-8(7(2)17-6)18(15,16)14-10-5-12-9(11)4-13-10/h3-5H,1-2H3,(H,13,14) |
| InChIKey | VCDHHOZTIPUGQA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |