C18H22N4O2 — CID 86807516
1-(2-phenoxyethyl)-3-(4-pyrrolidin-1-yl-3-pyridinyl)urea (PubChem CID 86807516) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-(2-phenoxyethyl)-3-(4-pyrrolidin-1-yl-3-pyridinyl)urea.
| Compound Name | 1-(2-phenoxyethyl)-3-(4-pyrrolidin-1-yl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 86807516 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-(2-phenoxyethyl)-3-(4-pyrrolidin-1-yl-3-pyridinyl)urea |
| SMILES | O=C(NCCOc1ccccc1)Nc1cnccc1N1CCCC1 |
| InChI | InChI=1S/C18H22N4O2/c23-18(20-10-13-24-15-6-2-1-3-7-15)21-16-14-19-9-8-17(16)22-11-4-5-12-22/h1-3,6-9,14H,4-5,10-13H2,(H2,20,21,23) |
| InChIKey | HASMQLKIPFADOG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|