C20H25N3O3S — CID 86807763
4-(dimethylamino)-N-methyl-N-(2-oxo-1-phenylpiperidin-3-yl)benzenesulfonamide (PubChem CID 86807763) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 4-(dimethylamino)-N-methyl-N-(2-oxo-1-phenylpiperidin-3-yl)benzenesulfonamide.
| Compound Name | 4-(dimethylamino)-N-methyl-N-(2-oxo-1-phenylpiperidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 86807763 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 4-(dimethylamino)-N-methyl-N-(2-oxo-1-phenylpiperidin-3-yl)benzenesulfonamide |
| SMILES | CN(C)c1ccc(S(=O)(=O)N(C)C2CCCN(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C20H25N3O3S/c1-21(2)16-11-13-18(14-12-16)27(25,26)22(3)19-10-7-15-23(20(19)24)17-8-5-4-6-9-17/h4-6,8-9,11-14,19H,7,10,15H2,1-3H3 |
| InChIKey | PDGGTCJWYWDHNW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |