C16H23N3O2 — CID 119328406
4-amino-N-methyl-N-(2-oxo-1-phenylpiperidin-3-yl)butanamide (PubChem CID 119328406) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-amino-N-methyl-N-(2-oxo-1-phenylpiperidin-3-yl)butanamide.
| Compound Name | 4-amino-N-methyl-N-(2-oxo-1-phenylpiperidin-3-yl)butanamide |
|---|---|
| PubChem CID | 119328406 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-amino-N-methyl-N-(2-oxo-1-phenylpiperidin-3-yl)butanamide |
| SMILES | CN(C(=O)CCCN)C1CCCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H23N3O2/c1-18(15(20)10-5-11-17)14-9-6-12-19(16(14)21)13-7-3-2-4-8-13/h2-4,7-8,14H,5-6,9-12,17H2,1H3 |
| InChIKey | VIJBGUQDYHAMMR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |