C20H32ClN3O4 — CID 119815316
7-amino-N-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]-N-methylheptanamide;hydrochloride (PubChem CID 119815316) has the molecular formula C20H32ClN3O4 and a molecular weight of 413.95 g/mol. Its IUPAC name is 7-amino-N-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]-N-methylheptanamide;hydrochloride.
| Compound Name | 7-amino-N-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]-N-methylheptanamide;hydrochloride |
|---|---|
| PubChem CID | 119815316 |
| Molecular Formula | C20H32ClN3O4 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 7-amino-N-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]-N-methylheptanamide;hydrochloride |
| SMILES | COc1cc(OC)cc(N2CCC(N(C)C(=O)CCCCCCN)C2=O)c1.Cl |
| InChI | InChI=1S/C20H31N3O4.ClH/c1-22(19(24)8-6-4-5-7-10-21)18-9-11-23(20(18)25)15-12-16(26-2)14-17(13-15)27-3;/h12-14,18H,4-11,21H2,1-3H3;1H |
| InChIKey | BZIHBYOPXBXTSE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|