C21H30N4O5 — CID 139014730
N'-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]-N-[(1-ethylazetidin-2-yl)methyl]-N'-methyloxamide (PubChem CID 139014730) has the molecular formula C21H30N4O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is N'-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]-N-[(1-ethylazetidin-2-yl)methyl]-N'-methyloxamide.
| Compound Name | N'-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]-N-[(1-ethylazetidin-2-yl)methyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 139014730 |
| Molecular Formula | C21H30N4O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N'-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]-N-[(1-ethylazetidin-2-yl)methyl]-N'-methyloxamide |
| SMILES | CCN1CCC1CNC(=O)C(=O)N(C)C1CCN(c2cc(OC)cc(OC)c2)C1=O |
| InChI | InChI=1S/C21H30N4O5/c1-5-24-8-6-14(24)13-22-19(26)21(28)23(2)18-7-9-25(20(18)27)15-10-16(29-3)12-17(11-15)30-4/h10-12,14,18H,5-9,13H2,1-4H3,(H,22,26) |
| InChIKey | IDDOEFFZPSTELE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|