C22H28ClN3O4 — CID 120611677
3-(2-aminophenyl)-N-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]-N-methylpropanamide;hydrochloride (PubChem CID 120611677) has the molecular formula C22H28ClN3O4 and a molecular weight of 433.94 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]-N-methylpropanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]-N-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120611677 |
| Molecular Formula | C22H28ClN3O4 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 3-(2-aminophenyl)-N-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]-N-methylpropanamide;hydrochloride |
| SMILES | COc1cc(OC)cc(N2CCC(N(C)C(=O)CCc3ccccc3N)C2=O)c1.Cl |
| InChI | InChI=1S/C22H27N3O4.ClH/c1-24(21(26)9-8-15-6-4-5-7-19(15)23)20-10-11-25(22(20)27)16-12-17(28-2)14-18(13-16)29-3;/h4-7,12-14,20H,8-11,23H2,1-3H3;1H |
| InChIKey | KBJAGKITOMZZEX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|