C22H26N2O4 — CID 86936136
3-(2-methoxy-4-methylphenoxy)-N-methyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)propanamide (PubChem CID 86936136) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-(2-methoxy-4-methylphenoxy)-N-methyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)propanamide.
| Compound Name | 3-(2-methoxy-4-methylphenoxy)-N-methyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 86936136 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 3-(2-methoxy-4-methylphenoxy)-N-methyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)propanamide |
| SMILES | COc1cc(C)ccc1OCCC(=O)N(C)C1CCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C22H26N2O4/c1-16-9-10-19(20(15-16)27-3)28-14-12-21(25)23(2)18-11-13-24(22(18)26)17-7-5-4-6-8-17/h4-10,15,18H,11-14H2,1-3H3 |
| InChIKey | TWODNDIEVGJZRG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |