C18H27N3O2 — CID 119792253
2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide (PubChem CID 119792253) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide.
| Compound Name | 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide |
|---|---|
| PubChem CID | 119792253 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide |
| SMILES | CCCC(C)(N)C(=O)N(C)C1CCCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H27N3O2/c1-4-12-18(2,19)17(23)20(3)15-11-8-13-21(16(15)22)14-9-6-5-7-10-14/h5-7,9-10,15H,4,8,11-13,19H2,1-3H3 |
| InChIKey | JWYHUCPJPOCDPM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |