C22H36N2O3 — CID 86809294
butyl 4-(cyclohexylcarbamoyl)-6,7-dimethyl-4-azatricyclo[4.3.0.03,7]nonane-3-carboxylate (PubChem CID 86809294) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is butyl 4-(cyclohexylcarbamoyl)-6,7-dimethyl-4-azatricyclo[4.3.0.03,7]nonane-3-carboxylate.
| Compound Name | butyl 4-(cyclohexylcarbamoyl)-6,7-dimethyl-4-azatricyclo[4.3.0.03,7]nonane-3-carboxylate |
|---|---|
| PubChem CID | 86809294 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | butyl 4-(cyclohexylcarbamoyl)-6,7-dimethyl-4-azatricyclo[4.3.0.03,7]nonane-3-carboxylate |
| SMILES | CCCCOC(=O)C12CC3CCC1(C)C3(C)CN2C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H36N2O3/c1-4-5-13-27-18(25)22-14-16-11-12-21(22,3)20(16,2)15-24(22)19(26)23-17-9-7-6-8-10-17/h16-17H,4-15H2,1-3H3,(H,23,26) |
| InChIKey | FRAQXKABEVEBQJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|