C19H25NO6S — CID 86809334
butyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate (PubChem CID 86809334) has the molecular formula C19H25NO6S and a molecular weight of 395.48 g/mol. Its IUPAC name is butyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate.
| Compound Name | butyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate |
|---|---|
| PubChem CID | 86809334 |
| Molecular Formula | C19H25NO6S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | butyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate |
| SMILES | CCCCOC(=O)C1C2CCC(C2)N1S(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H25NO6S/c1-2-3-8-26-19(21)18-13-4-5-14(11-13)20(18)27(22,23)15-6-7-16-17(12-15)25-10-9-24-16/h6-7,12-14,18H,2-5,8-11H2,1H3 |
| InChIKey | BXKSOUPKJGAMBL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|