C8H14F3N3O2 — CID 86811881
N-propyl-2-(2,2,2-trifluoroethylcarbamoylamino)acetamide (PubChem CID 86811881) has the molecular formula C8H14F3N3O2 and a molecular weight of 241.21 g/mol. Its IUPAC name is N-propyl-2-(2,2,2-trifluoroethylcarbamoylamino)acetamide.
| Compound Name | N-propyl-2-(2,2,2-trifluoroethylcarbamoylamino)acetamide |
|---|---|
| PubChem CID | 86811881 |
| Molecular Formula | C8H14F3N3O2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N-propyl-2-(2,2,2-trifluoroethylcarbamoylamino)acetamide |
| SMILES | CCCNC(=O)CNC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O2/c1-2-3-12-6(15)4-13-7(16)14-5-8(9,10)11/h2-5H2,1H3,(H,12,15)(H2,13,14,16) |
| InChIKey | PDWLPRZGBPLVLZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |