C7H12F3N3O2 — CID 87451881
N-[2-(ethylcarbamoylamino)ethyl]-2,2,2-trifluoroacetamide (PubChem CID 87451881) has the molecular formula C7H12F3N3O2 and a molecular weight of 227.19 g/mol. Its IUPAC name is N-[2-(ethylcarbamoylamino)ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(ethylcarbamoylamino)ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 87451881 |
| Molecular Formula | C7H12F3N3O2 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N-[2-(ethylcarbamoylamino)ethyl]-2,2,2-trifluoroacetamide |
| SMILES | CCNC(=O)NCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H12F3N3O2/c1-2-11-6(15)13-4-3-12-5(14)7(8,9)10/h2-4H2,1H3,(H,12,14)(H2,11,13,15) |
| InChIKey | MDEBZJFNKPUCOY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|