C16H22Cl2N4O2 — CID 86813884
N-(2-aminopentyl)-3-pyrazin-2-yloxybenzamide;dihydrochloride (PubChem CID 86813884) has the molecular formula C16H22Cl2N4O2 and a molecular weight of 373.28 g/mol. Its IUPAC name is N-(2-aminopentyl)-3-pyrazin-2-yloxybenzamide;dihydrochloride.
| Compound Name | N-(2-aminopentyl)-3-pyrazin-2-yloxybenzamide;dihydrochloride |
|---|---|
| PubChem CID | 86813884 |
| Molecular Formula | C16H22Cl2N4O2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-(2-aminopentyl)-3-pyrazin-2-yloxybenzamide;dihydrochloride |
| SMILES | CCCC(N)CNC(=O)c1cccc(Oc2cnccn2)c1.Cl.Cl |
| InChI | InChI=1S/C16H20N4O2.2ClH/c1-2-4-13(17)10-20-16(21)12-5-3-6-14(9-12)22-15-11-18-7-8-19-15;;/h3,5-9,11,13H,2,4,10,17H2,1H3,(H,20,21);2*1H |
| InChIKey | AVCORKAAMIJMAS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |