C16H20N4O2 — CID 86813885
N-(2-aminopentyl)-3-pyrazin-2-yloxybenzamide (PubChem CID 86813885) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-(2-aminopentyl)-3-pyrazin-2-yloxybenzamide.
| Compound Name | N-(2-aminopentyl)-3-pyrazin-2-yloxybenzamide |
|---|---|
| PubChem CID | 86813885 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-(2-aminopentyl)-3-pyrazin-2-yloxybenzamide |
| SMILES | CCCC(N)CNC(=O)c1cccc(Oc2cnccn2)c1 |
| InChI | InChI=1S/C16H20N4O2/c1-2-4-13(17)10-20-16(21)12-5-3-6-14(9-12)22-15-11-18-7-8-19-15/h3,5-9,11,13H,2,4,10,17H2,1H3,(H,20,21) |
| InChIKey | IKJLRVQXFONKIN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |