C22H28ClN3O3 — CID 86813960
3-amino-N-[1-[2-(2-methoxyphenyl)acetyl]piperidin-4-yl]-4-methylbenzamide;hydrochloride (PubChem CID 86813960) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is 3-amino-N-[1-[2-(2-methoxyphenyl)acetyl]piperidin-4-yl]-4-methylbenzamide;hydrochloride.
| Compound Name | 3-amino-N-[1-[2-(2-methoxyphenyl)acetyl]piperidin-4-yl]-4-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 86813960 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-amino-N-[1-[2-(2-methoxyphenyl)acetyl]piperidin-4-yl]-4-methylbenzamide;hydrochloride |
| SMILES | COc1ccccc1CC(=O)N1CCC(NC(=O)c2ccc(C)c(N)c2)CC1.Cl |
| InChI | InChI=1S/C22H27N3O3.ClH/c1-15-7-8-17(13-19(15)23)22(27)24-18-9-11-25(12-10-18)21(26)14-16-5-3-4-6-20(16)28-2;/h3-8,13,18H,9-12,14,23H2,1-2H3,(H,24,27);1H |
| InChIKey | VCTVPFDRUPFOQV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|