C19H28F2N4O3 — CID 86815408
2-(2-acetamidoethylamino)-N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methylpropanamide (PubChem CID 86815408) has the molecular formula C19H28F2N4O3 and a molecular weight of 398.45 g/mol. Its IUPAC name is 2-(2-acetamidoethylamino)-N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methylpropanamide.
| Compound Name | 2-(2-acetamidoethylamino)-N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 86815408 |
| Molecular Formula | C19H28F2N4O3 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-(2-acetamidoethylamino)-N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methylpropanamide |
| SMILES | CC(=O)NCCNC(C)(C)C(=O)NC1CCN(c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C19H28F2N4O3/c1-13(26)22-9-10-23-19(2,3)17(27)24-14-8-11-25(12-14)15-6-4-5-7-16(15)28-18(20)21/h4-7,14,18,23H,8-12H2,1-3H3,(H,22,26)(H,24,27) |
| InChIKey | XYZROMMEPLSIDE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|