C15H17N3O2 — CID 86817334
1-[3-(5-methyl-1,3-oxazol-2-yl)phenyl]-3-(2-methylprop-2-enyl)urea (PubChem CID 86817334) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-[3-(5-methyl-1,3-oxazol-2-yl)phenyl]-3-(2-methylprop-2-enyl)urea.
| Compound Name | 1-[3-(5-methyl-1,3-oxazol-2-yl)phenyl]-3-(2-methylprop-2-enyl)urea |
|---|---|
| PubChem CID | 86817334 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-[3-(5-methyl-1,3-oxazol-2-yl)phenyl]-3-(2-methylprop-2-enyl)urea |
| SMILES | C=C(C)CNC(=O)Nc1cccc(-c2ncc(C)o2)c1 |
| InChI | InChI=1S/C15H17N3O2/c1-10(2)8-17-15(19)18-13-6-4-5-12(7-13)14-16-9-11(3)20-14/h4-7,9H,1,8H2,2-3H3,(H2,17,18,19) |
| InChIKey | NQCSMHKHDRGCMN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|