About 3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline
3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline (PubChem CID 115885071) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline.
Molecular Properties
| Compound Name | 3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline |
| PubChem CID | 115885071 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline |
| SMILES | Cc1cnc(-c2cccc(NC(C)C)c2)o1 |
| InChI | InChI=1S/C13H16N2O/c1-9(2)15-12-6-4-5-11(7-12)13-14-8-10(3)16-13/h4-9,15H,1-3H3 |
| InChIKey | GXLGZNJAYGXVGG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline?
The IUPAC name of 3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline (CID 115885071) is 3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline.
What is the SMILES notation for 3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline?
The canonical SMILES for 3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline is Cc1cnc(-c2cccc(NC(C)C)c2)o1.
What is the InChIKey of 3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline?
The InChIKey is GXLGZNJAYGXVGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-9(2)15-12-6-4-5-11(7-12)13-14-8-10(3)16-13/h4-9,15H,1-3H3.
What are the key properties of 3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline?
3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline has a molecular weight of 216.28 g/mol, XLogP of 3.47, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methyl-1,3-oxazol-2-yl)-N-propan-2-ylaniline is sourced from PubChem (CID 115885071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).