C14H15FN4O2S — CID 86817931
N-(4-cyano-1-ethylpyrazol-5-yl)-1-(3-fluoro-4-methylphenyl)methanesulfonamide (PubChem CID 86817931) has the molecular formula C14H15FN4O2S and a molecular weight of 322.37 g/mol. Its IUPAC name is N-(4-cyano-1-ethylpyrazol-5-yl)-1-(3-fluoro-4-methylphenyl)methanesulfonamide.
| Compound Name | N-(4-cyano-1-ethylpyrazol-5-yl)-1-(3-fluoro-4-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 86817931 |
| Molecular Formula | C14H15FN4O2S |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-(4-cyano-1-ethylpyrazol-5-yl)-1-(3-fluoro-4-methylphenyl)methanesulfonamide |
| SMILES | CCn1ncc(C#N)c1NS(=O)(=O)Cc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C14H15FN4O2S/c1-3-19-14(12(7-16)8-17-19)18-22(20,21)9-11-5-4-10(2)13(15)6-11/h4-6,8,18H,3,9H2,1-2H3 |
| InChIKey | URQYFKUNIVPIME-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |