C15H19N3O — CID 86819232
N'-[1-(3-cyanophenyl)ethoxy]cyclopentanecarboximidamide (PubChem CID 86819232) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is N'-[1-(3-cyanophenyl)ethoxy]cyclopentanecarboximidamide.
| Compound Name | N'-[1-(3-cyanophenyl)ethoxy]cyclopentanecarboximidamide |
|---|---|
| PubChem CID | 86819232 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N'-[1-(3-cyanophenyl)ethoxy]cyclopentanecarboximidamide |
| SMILES | CC(O/N=C(/N)C1CCCC1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H19N3O/c1-11(14-8-4-5-12(9-14)10-16)19-18-15(17)13-6-2-3-7-13/h4-5,8-9,11,13H,2-3,6-7H2,1H3,(H2,17,18) |
| InChIKey | CQVTXDXRUSKFDJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|