C16H26N2O5S2 — CID 86819856
N-[4-(4-hydroxy-2-methylpiperidin-1-yl)sulfonylphenyl]butane-1-sulfonamide (PubChem CID 86819856) has the molecular formula C16H26N2O5S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[4-(4-hydroxy-2-methylpiperidin-1-yl)sulfonylphenyl]butane-1-sulfonamide.
| Compound Name | N-[4-(4-hydroxy-2-methylpiperidin-1-yl)sulfonylphenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 86819856 |
| Molecular Formula | C16H26N2O5S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-[4-(4-hydroxy-2-methylpiperidin-1-yl)sulfonylphenyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1ccc(S(=O)(=O)N2CCC(O)CC2C)cc1 |
| InChI | InChI=1S/C16H26N2O5S2/c1-3-4-11-24(20,21)17-14-5-7-16(8-6-14)25(22,23)18-10-9-15(19)12-13(18)2/h5-8,13,15,17,19H,3-4,9-12H2,1-2H3 |
| InChIKey | XWJUPOBQKBPMOT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |