C16H27N3O4S2 — CID 120725464
N-[4-(2,3-dimethylpiperazin-1-yl)sulfonylphenyl]butane-1-sulfonamide (PubChem CID 120725464) has the molecular formula C16H27N3O4S2 and a molecular weight of 389.54 g/mol. Its IUPAC name is N-[4-(2,3-dimethylpiperazin-1-yl)sulfonylphenyl]butane-1-sulfonamide.
| Compound Name | N-[4-(2,3-dimethylpiperazin-1-yl)sulfonylphenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 120725464 |
| Molecular Formula | C16H27N3O4S2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[4-(2,3-dimethylpiperazin-1-yl)sulfonylphenyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1ccc(S(=O)(=O)N2CCNC(C)C2C)cc1 |
| InChI | InChI=1S/C16H27N3O4S2/c1-4-5-12-24(20,21)18-15-6-8-16(9-7-15)25(22,23)19-11-10-17-13(2)14(19)3/h6-9,13-14,17-18H,4-5,10-12H2,1-3H3 |
| InChIKey | IFMHBHUGASPFLX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |