C19H25N3O4S — CID 86821808
N-[2-(ethoxymethyl)phenyl]-1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide (PubChem CID 86821808) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[2-(ethoxymethyl)phenyl]-1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide.
| Compound Name | N-[2-(ethoxymethyl)phenyl]-1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 86821808 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[2-(ethoxymethyl)phenyl]-1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
| SMILES | CCOCc1ccccc1NC(=O)c1cc(S(=O)(=O)N2CCCC2)cn1C |
| InChI | InChI=1S/C19H25N3O4S/c1-3-26-14-15-8-4-5-9-17(15)20-19(23)18-12-16(13-21(18)2)27(24,25)22-10-6-7-11-22/h4-5,8-9,12-13H,3,6-7,10-11,14H2,1-2H3,(H,20,23) |
| InChIKey | FOWIUAWCSPSAGK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |