C16H20N4O4S — CID 75421055
1-methyl-N-(1-methyl-2-oxo-3-pyridinyl)-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide (PubChem CID 75421055) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is 1-methyl-N-(1-methyl-2-oxo-3-pyridinyl)-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-(1-methyl-2-oxo-3-pyridinyl)-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 75421055 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-methyl-N-(1-methyl-2-oxo-3-pyridinyl)-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)N2CCCC2)cc1C(=O)Nc1cccn(C)c1=O |
| InChI | InChI=1S/C16H20N4O4S/c1-18-7-5-6-13(16(18)22)17-15(21)14-10-12(11-19(14)2)25(23,24)20-8-3-4-9-20/h5-7,10-11H,3-4,8-9H2,1-2H3,(H,17,21) |
| InChIKey | XGCFZCCTYBZKAW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |