C18H30N4O3 — CID 86823322
5,5-diethyl-3-[2-oxo-2-(3-pyrrolidin-1-ylpiperidin-1-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 86823322) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 5,5-diethyl-3-[2-oxo-2-(3-pyrrolidin-1-ylpiperidin-1-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-diethyl-3-[2-oxo-2-(3-pyrrolidin-1-ylpiperidin-1-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 86823322 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 5,5-diethyl-3-[2-oxo-2-(3-pyrrolidin-1-ylpiperidin-1-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)N2CCCC(N3CCCC3)C2)C1=O |
| InChI | InChI=1S/C18H30N4O3/c1-3-18(4-2)16(24)22(17(25)19-18)13-15(23)21-11-7-8-14(12-21)20-9-5-6-10-20/h14H,3-13H2,1-2H3,(H,19,25) |
| InChIKey | GIUVLCBBDNLJMB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|