C16H25N3O5 — CID 122114372
1-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]-6-methylpiperidine-3-carboxylic acid (PubChem CID 122114372) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]-6-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]-6-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122114372 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]-6-methylpiperidine-3-carboxylic acid |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)N2CC(C(=O)O)CCC2C)C1=O |
| InChI | InChI=1S/C16H25N3O5/c1-4-16(5-2)14(23)19(15(24)17-16)9-12(20)18-8-11(13(21)22)7-6-10(18)3/h10-11H,4-9H2,1-3H3,(H,17,24)(H,21,22) |
| InChIKey | KRCQBOPREXLYQJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|