C15H26N4O3 — CID 120573174
3-[2-(2,3-dimethylpiperazin-1-yl)-2-oxoethyl]-5,5-diethylimidazolidine-2,4-dione (PubChem CID 120573174) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-[2-(2,3-dimethylpiperazin-1-yl)-2-oxoethyl]-5,5-diethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(2,3-dimethylpiperazin-1-yl)-2-oxoethyl]-5,5-diethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 120573174 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 3-[2-(2,3-dimethylpiperazin-1-yl)-2-oxoethyl]-5,5-diethylimidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)N2CCNC(C)C2C)C1=O |
| InChI | InChI=1S/C15H26N4O3/c1-5-15(6-2)13(21)19(14(22)17-15)9-12(20)18-8-7-16-10(3)11(18)4/h10-11,16H,5-9H2,1-4H3,(H,17,22) |
| InChIKey | UKDXLOSEMJUHJN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|