C17H34N4O3S — CID 86823860
N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-methylsulfonylpiperidine-2-carboxamide (PubChem CID 86823860) has the molecular formula C17H34N4O3S and a molecular weight of 374.55 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-methylsulfonylpiperidine-2-carboxamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-methylsulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 86823860 |
| Molecular Formula | C17H34N4O3S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-methylsulfonylpiperidine-2-carboxamide |
| SMILES | CCN1CCN(CC(C)CNC(=O)C2CCCCN2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C17H34N4O3S/c1-4-19-9-11-20(12-10-19)14-15(2)13-18-17(22)16-7-5-6-8-21(16)25(3,23)24/h15-16H,4-14H2,1-3H3,(H,18,22) |
| InChIKey | AZSPPNDBPNTFAH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |