C19H38N4O — CID 95967578
1-cycloheptyl-3-[(2S)-3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-methylurea (PubChem CID 95967578) has the molecular formula C19H38N4O and a molecular weight of 338.54 g/mol. Its IUPAC name is 1-cycloheptyl-3-[(2S)-3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-methylurea.
| Compound Name | 1-cycloheptyl-3-[(2S)-3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-methylurea |
|---|---|
| PubChem CID | 95967578 |
| Molecular Formula | C19H38N4O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | 1-cycloheptyl-3-[(2S)-3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-methylurea |
| SMILES | CCN1CCN(C[C@@H](C)CNC(=O)N(C)C2CCCCCC2)CC1 |
| InChI | InChI=1S/C19H38N4O/c1-4-22-11-13-23(14-12-22)16-17(2)15-20-19(24)21(3)18-9-7-5-6-8-10-18/h17-18H,4-16H2,1-3H3,(H,20,24)/t17-/m0/s1 |
| InChIKey | HDZKQUBXZLADFB-KRWDZBQOSA-N |
| XLogP | 2.62 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |