C14H19N5 — CID 86827304
N-[(1-cyclopropyltetrazol-5-yl)methyl]-N-ethyl-2-methylaniline (PubChem CID 86827304) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is N-[(1-cyclopropyltetrazol-5-yl)methyl]-N-ethyl-2-methylaniline.
| Compound Name | N-[(1-cyclopropyltetrazol-5-yl)methyl]-N-ethyl-2-methylaniline |
|---|---|
| PubChem CID | 86827304 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-[(1-cyclopropyltetrazol-5-yl)methyl]-N-ethyl-2-methylaniline |
| SMILES | CCN(Cc1nnnn1C1CC1)c1ccccc1C |
| InChI | InChI=1S/C14H19N5/c1-3-18(13-7-5-4-6-11(13)2)10-14-15-16-17-19(14)12-8-9-12/h4-7,12H,3,8-10H2,1-2H3 |
| InChIKey | IOGQEGQGLANIRF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |