C16H24N8O — CID 71872591
N-[[4-[(1-cyclopropyltetrazol-5-yl)methyl]morpholin-2-yl]methyl]-N-ethylpyridazin-3-amine (PubChem CID 71872591) has the molecular formula C16H24N8O and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[[4-[(1-cyclopropyltetrazol-5-yl)methyl]morpholin-2-yl]methyl]-N-ethylpyridazin-3-amine.
| Compound Name | N-[[4-[(1-cyclopropyltetrazol-5-yl)methyl]morpholin-2-yl]methyl]-N-ethylpyridazin-3-amine |
|---|---|
| PubChem CID | 71872591 |
| Molecular Formula | C16H24N8O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-[[4-[(1-cyclopropyltetrazol-5-yl)methyl]morpholin-2-yl]methyl]-N-ethylpyridazin-3-amine |
| SMILES | CCN(CC1CN(Cc2nnnn2C2CC2)CCO1)c1cccnn1 |
| InChI | InChI=1S/C16H24N8O/c1-2-23(15-4-3-7-17-18-15)11-14-10-22(8-9-25-14)12-16-19-20-21-24(16)13-5-6-13/h3-4,7,13-14H,2,5-6,8-12H2,1H3 |
| InChIKey | XNUBPXMTIJTDHJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 85.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |