C19H26N4O2 — CID 100870344
(1S)-2-[(2S)-2-[[ethyl(pyridazin-3-yl)amino]methyl]morpholin-4-yl]-1-phenylethanol (PubChem CID 100870344) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (1S)-2-[(2S)-2-[[ethyl(pyridazin-3-yl)amino]methyl]morpholin-4-yl]-1-phenylethanol.
| Compound Name | (1S)-2-[(2S)-2-[[ethyl(pyridazin-3-yl)amino]methyl]morpholin-4-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 100870344 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (1S)-2-[(2S)-2-[[ethyl(pyridazin-3-yl)amino]methyl]morpholin-4-yl]-1-phenylethanol |
| SMILES | CCN(C[C@@H]1CN(C[C@@H](O)c2ccccc2)CCO1)c1cccnn1 |
| InChI | InChI=1S/C19H26N4O2/c1-2-23(19-9-6-10-20-21-19)14-17-13-22(11-12-25-17)15-18(24)16-7-4-3-5-8-16/h3-10,17-18,24H,2,11-15H2,1H3/t17-,18+/m0/s1 |
| InChIKey | ZQUXLRCPGXDVJH-ZWKOTPCHSA-N |
| XLogP | 1.74 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |