C15H22N6O — CID 71872607
N-ethyl-N-[[4-(1H-imidazol-2-ylmethyl)morpholin-2-yl]methyl]pyridazin-3-amine (PubChem CID 71872607) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is N-ethyl-N-[[4-(1H-imidazol-2-ylmethyl)morpholin-2-yl]methyl]pyridazin-3-amine.
| Compound Name | N-ethyl-N-[[4-(1H-imidazol-2-ylmethyl)morpholin-2-yl]methyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 71872607 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | N-ethyl-N-[[4-(1H-imidazol-2-ylmethyl)morpholin-2-yl]methyl]pyridazin-3-amine |
| SMILES | CCN(CC1CN(Cc2ncc[nH]2)CCO1)c1cccnn1 |
| InChI | InChI=1S/C15H22N6O/c1-2-21(15-4-3-5-18-19-15)11-13-10-20(8-9-22-13)12-14-16-6-7-17-14/h3-7,13H,2,8-12H2,1H3,(H,16,17) |
| InChIKey | CAMYRQDIXGTUIX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |